C20H24N2O3S2 — CID 69407821
1-[1-(4-methoxyphenyl)sulfonyl-2-methylindol-3-yl]sulfanyl-N,N-dimethylethanamine (PubChem CID 69407821) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)sulfonyl-2-methylindol-3-yl]sulfanyl-N,N-dimethylethanamine.
| Compound Name | 1-[1-(4-methoxyphenyl)sulfonyl-2-methylindol-3-yl]sulfanyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 69407821 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)sulfonyl-2-methylindol-3-yl]sulfanyl-N,N-dimethylethanamine |
| SMILES | COc1ccc(S(=O)(=O)n2c(C)c(SC(C)N(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H24N2O3S2/c1-14-20(26-15(2)21(3)4)18-8-6-7-9-19(18)22(14)27(23,24)17-12-10-16(25-5)11-13-17/h6-13,15H,1-5H3 |
| InChIKey | PBVRBIZMDATKKB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|