C22H19N5O2S — CID 69408526
2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide (PubChem CID 69408526) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide.
| Compound Name | 2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 69408526 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[(5-benzyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(furan-2-ylmethylideneamino)acetamide |
| SMILES | O=C(CSc1nnc(Cc2ccccc2)n1-c1ccccc1)NN=Cc1ccco1 |
| InChI | InChI=1S/C22H19N5O2S/c28-21(25-23-15-19-12-7-13-29-19)16-30-22-26-24-20(14-17-8-3-1-4-9-17)27(22)18-10-5-2-6-11-18/h1-13,15H,14,16H2,(H,25,28) |
| InChIKey | IRNUTUALVDOCQM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|