C26H14ClF2NO — CID 69410903
5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-12-fluorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (PubChem CID 69410903) has the molecular formula C26H14ClF2NO and a molecular weight of 429.85 g/mol. Its IUPAC name is 5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-12-fluorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one.
| Compound Name | 5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-12-fluorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 69410903 |
| Molecular Formula | C26H14ClF2NO |
| Molecular Weight | 429.85 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 5-[2-(7-chloro-6-fluoroquinolin-2-yl)ethenyl]-12-fluorotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| SMILES | O=c1c2cc(C=Cc3ccc4cc(F)c(Cl)cc4n3)ccc2ccc2c(F)cccc12 |
| InChI | InChI=1S/C26H14ClF2NO/c27-22-14-25-17(13-24(22)29)7-10-18(30-25)9-5-15-4-6-16-8-11-19-20(2-1-3-23(19)28)26(31)21(16)12-15/h1-14H |
| InChIKey | NEOYDQDVMAZVMK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.85 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |