C30H31NO6 — CID 69411543
methyl 4-[4-[4-[[3-(2-acetamidoethyl)-1-benzofuran-5-yl]oxy]butoxy]phenyl]benzoate (PubChem CID 69411543) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is methyl 4-[4-[4-[[3-(2-acetamidoethyl)-1-benzofuran-5-yl]oxy]butoxy]phenyl]benzoate.
| Compound Name | methyl 4-[4-[4-[[3-(2-acetamidoethyl)-1-benzofuran-5-yl]oxy]butoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 69411543 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | methyl 4-[4-[4-[[3-(2-acetamidoethyl)-1-benzofuran-5-yl]oxy]butoxy]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(OCCCCOc3ccc4occ(CCNC(C)=O)c4c3)cc2)cc1 |
| InChI | InChI=1S/C30H31NO6/c1-21(32)31-16-15-25-20-37-29-14-13-27(19-28(25)29)36-18-4-3-17-35-26-11-9-23(10-12-26)22-5-7-24(8-6-22)30(33)34-2/h5-14,19-20H,3-4,15-18H2,1-2H3,(H,31,32) |
| InChIKey | VWDBORSFNMABIM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|