C33H34N2O4S — CID 18360740
N-[3-[5-[3-(2-acetamidoethyl)-2-[(3-methoxyphenyl)methyl]-1-benzothiophen-5-yl]-1-benzofuran-3-yl]propyl]acetamide (PubChem CID 18360740) has the molecular formula C33H34N2O4S and a molecular weight of 554.71 g/mol. Its IUPAC name is N-[3-[5-[3-(2-acetamidoethyl)-2-[(3-methoxyphenyl)methyl]-1-benzothiophen-5-yl]-1-benzofuran-3-yl]propyl]acetamide.
| Compound Name | N-[3-[5-[3-(2-acetamidoethyl)-2-[(3-methoxyphenyl)methyl]-1-benzothiophen-5-yl]-1-benzofuran-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 18360740 |
| Molecular Formula | C33H34N2O4S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | N-[3-[5-[3-(2-acetamidoethyl)-2-[(3-methoxyphenyl)methyl]-1-benzothiophen-5-yl]-1-benzofuran-3-yl]propyl]acetamide |
| SMILES | COc1cccc(Cc2sc3ccc(-c4ccc5occ(CCCNC(C)=O)c5c4)cc3c2CCNC(C)=O)c1 |
| InChI | InChI=1S/C33H34N2O4S/c1-21(36)34-14-5-7-26-20-39-31-11-9-24(18-29(26)31)25-10-12-32-30(19-25)28(13-15-35-22(2)37)33(40-32)17-23-6-4-8-27(16-23)38-3/h4,6,8-12,16,18-20H,5,7,13-15,17H2,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | LZWQRXLZCMNJES-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|