C13H12ClF3N4S — CID 69411908
[5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidenehydrazine (PubChem CID 69411908) has the molecular formula C13H12ClF3N4S and a molecular weight of 348.78 g/mol. Its IUPAC name is [5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidenehydrazine.
| Compound Name | [5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidenehydrazine |
|---|---|
| PubChem CID | 69411908 |
| Molecular Formula | C13H12ClF3N4S |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | [5-[(2-chlorophenyl)methylsulfanyl]-1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methylidenehydrazine |
| SMILES | Cn1nc(C(F)(F)F)c(C=NN)c1SCc1ccccc1Cl |
| InChI | InChI=1S/C13H12ClF3N4S/c1-21-12(22-7-8-4-2-3-5-10(8)14)9(6-19-18)11(20-21)13(15,16)17/h2-6H,7,18H2,1H3 |
| InChIKey | ARSTWGGUNHLIQV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|