C31H27F3N4O5 — CID 69415519
2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[5-(3-methoxyphenyl)-2-oxo-1-[(2,3,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetic acid (PubChem CID 69415519) has the molecular formula C31H27F3N4O5 and a molecular weight of 592.57 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[5-(3-methoxyphenyl)-2-oxo-1-[(2,3,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetic acid.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[5-(3-methoxyphenyl)-2-oxo-1-[(2,3,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetic acid |
|---|---|
| PubChem CID | 69415519 |
| Molecular Formula | C31H27F3N4O5 |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[5-(3-methoxyphenyl)-2-oxo-1-[(2,3,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetic acid |
| SMILES | COc1cccc(C2(C(Oc3nc(C)cc(C)n3)C(=O)O)NCC(=O)N(Cc3c(F)ccc(F)c3F)c3ccccc32)c1 |
| InChI | InChI=1S/C31H27F3N4O5/c1-17-13-18(2)37-30(36-17)43-28(29(40)41)31(19-7-6-8-20(14-19)42-3)22-9-4-5-10-25(22)38(26(39)15-35-31)16-21-23(32)11-12-24(33)27(21)34/h4-14,28,35H,15-16H2,1-3H3,(H,40,41) |
| InChIKey | WCGNZJWJBLKXCL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|