C25H29NO3 — CID 69416729
2-methyl-4-[1-[3-(4-propan-2-ylphenyl)prop-2-enoyl]piperidin-3-yl]benzoic acid (PubChem CID 69416729) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-methyl-4-[1-[3-(4-propan-2-ylphenyl)prop-2-enoyl]piperidin-3-yl]benzoic acid.
| Compound Name | 2-methyl-4-[1-[3-(4-propan-2-ylphenyl)prop-2-enoyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 69416729 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-methyl-4-[1-[3-(4-propan-2-ylphenyl)prop-2-enoyl]piperidin-3-yl]benzoic acid |
| SMILES | Cc1cc(C2CCCN(C(=O)C=Cc3ccc(C(C)C)cc3)C2)ccc1C(=O)O |
| InChI | InChI=1S/C25H29NO3/c1-17(2)20-9-6-19(7-10-20)8-13-24(27)26-14-4-5-22(16-26)21-11-12-23(25(28)29)18(3)15-21/h6-13,15,17,22H,4-5,14,16H2,1-3H3,(H,28,29) |
| InChIKey | XIUFSABFMDFULJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|