C24H29NO7 — CID 69417150
diethyl 2-[[(14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]methylidene]propanedioate (PubChem CID 69417150) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is diethyl 2-[[(14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 69417150 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | diethyl 2-[[(14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1CCC23C=C[C@H](O)CC2Oc2c(OC)ccc(c23)C1)C(=O)OCC |
| InChI | InChI=1S/C24H29NO7/c1-4-30-22(27)17(23(28)31-5-2)14-25-11-10-24-9-8-16(26)12-19(24)32-21-18(29-3)7-6-15(13-25)20(21)24/h6-9,14,16,19,26H,4-5,10-13H2,1-3H3/t16-,19?,24?/m0/s1 |
| InChIKey | VEWBHCOWMXCZGF-YTXIBPJBSA-N |
| XLogP | 2.23 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|