C19H24N2O4 — CID 10132259
(1S,12S,14R)-N-ethyl-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide (PubChem CID 10132259) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,12S,14R)-N-ethyl-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide.
| Compound Name | (1S,12S,14R)-N-ethyl-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 10132259 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1S,12S,14R)-N-ethyl-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
| SMILES | CCNC(=O)N1CC[C@@]23C=C[C@H](O)C[C@@H]2Oc2c(OC)ccc(c23)C1 |
| InChI | InChI=1S/C19H24N2O4/c1-3-20-18(23)21-9-8-19-7-6-13(22)10-15(19)25-17-14(24-2)5-4-12(11-21)16(17)19/h4-7,13,15,22H,3,8-11H2,1-2H3,(H,20,23)/t13-,15-,19-/m0/s1 |
| InChIKey | IHLRKPFHHZYHHW-RFUYNDQBSA-N |
| XLogP | 1.95 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|