C28H41N3O6 — CID 71210932
tert-butyl N-[6-[(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carbonyl)amino]hexyl]carbamate (PubChem CID 71210932) has the molecular formula C28H41N3O6 and a molecular weight of 515.65 g/mol. Its IUPAC name is tert-butyl N-[6-[(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carbonyl)amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carbonyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 71210932 |
| Molecular Formula | C28H41N3O6 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | tert-butyl N-[6-[(14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carbonyl)amino]hexyl]carbamate |
| SMILES | COc1ccc2c3c1OC1CC(O)C=CC31CCN(C(=O)NCCCCCCNC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C28H41N3O6/c1-27(2,3)37-26(34)30-15-8-6-5-7-14-29-25(33)31-16-13-28-12-11-20(32)17-22(28)36-24-21(35-4)10-9-19(18-31)23(24)28/h9-12,20,22,32H,5-8,13-18H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | YHTBMCGGMYFZPK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|