C23H24N2O4 — CID 71209879
14-hydroxy-9-methoxy-N-phenyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide (PubChem CID 71209879) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 14-hydroxy-9-methoxy-N-phenyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide.
| Compound Name | 14-hydroxy-9-methoxy-N-phenyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 71209879 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 14-hydroxy-9-methoxy-N-phenyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxamide |
| SMILES | COc1ccc2c3c1OC1CC(O)C=CC31CCN(C(=O)Nc1ccccc1)C2 |
| InChI | InChI=1S/C23H24N2O4/c1-28-18-8-7-15-14-25(22(27)24-16-5-3-2-4-6-16)12-11-23-10-9-17(26)13-19(23)29-21(18)20(15)23/h2-10,17,19,26H,11-14H2,1H3,(H,24,27) |
| InChIKey | RJADBUDGUQEEPZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|