C33H37NO5Si — CID 16638863
[tert-butyl(diphenyl)silyl] (14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxylate (PubChem CID 16638863) has the molecular formula C33H37NO5Si and a molecular weight of 555.75 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl] (14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxylate.
| Compound Name | [tert-butyl(diphenyl)silyl] (14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 16638863 |
| Molecular Formula | C33H37NO5Si |
| Molecular Weight | 555.75 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | [tert-butyl(diphenyl)silyl] (14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxylate |
| SMILES | COc1ccc2c3c1OC1C[C@@H](O)C=CC31CCN(C(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C2 |
| InChI | InChI=1S/C33H37NO5Si/c1-32(2,3)40(25-11-7-5-8-12-25,26-13-9-6-10-14-26)39-31(36)34-20-19-33-18-17-24(35)21-28(33)38-30-27(37-4)16-15-23(22-34)29(30)33/h5-18,24,28,35H,19-22H2,1-4H3/t24-,28?,33?/m0/s1 |
| InChIKey | AKYIFWZTONJCKA-NHBSCRDWSA-N |
| XLogP | 4.92 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.75 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|