C16H25NO5 — CID 69417292
1-O-tert-butyl 2-O-methyl 5-(1-hydroxyprop-2-enyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate (PubChem CID 69417292) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 5-(1-hydroxyprop-2-enyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 5-(1-hydroxyprop-2-enyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69417292 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 5-(1-hydroxyprop-2-enyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
| SMILES | C=CC(O)C1=CCC(C(=O)OC)N(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H25NO5/c1-6-13(18)11-7-8-12(14(19)21-5)17(10-9-11)15(20)22-16(2,3)4/h6-7,12-13,18H,1,8-10H2,2-5H3 |
| InChIKey | LYJLICLWSLTYNE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|