C33H41F2N3O4S — CID 69418746
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-5-(3-thiophen-2-ylpropanoylamino)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 69418746) has the molecular formula C33H41F2N3O4S and a molecular weight of 613.77 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-5-(3-thiophen-2-ylpropanoylamino)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-5-(3-thiophen-2-ylpropanoylamino)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69418746 |
| Molecular Formula | C33H41F2N3O4S |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-5-(3-thiophen-2-ylpropanoylamino)pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CCNC(=O)CCc2cccs2)c1 |
| InChI | InChI=1S/C33H41F2N3O4S/c1-4-12-38(13-5-2)33(42)25-16-22(3)15-24(20-25)32(41)37-29(19-23-17-26(34)21-27(35)18-23)30(39)10-11-36-31(40)9-8-28-7-6-14-43-28/h6-7,14-18,20-21,29-30,39H,4-5,8-13,19H2,1-3H3,(H,36,40)(H,37,41)/t29-,30+/m0/s1 |
| InChIKey | CAOBOUKNHJIKFI-XZWHSSHBSA-N |
| XLogP | 5.44 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |