C33H45NO5 — CID 69419905
1-[4-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-4-methoxyphenyl]-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidin-1-yl]-2-phenylmethoxyethanone (PubChem CID 69419905) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is 1-[4-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-4-methoxyphenyl]-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidin-1-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[4-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-4-methoxyphenyl]-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidin-1-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 69419905 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 1-[4-[3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-4-methoxyphenyl]-3-[(1R)-1-hydroxyethyl]-3-methylpyrrolidin-1-yl]-2-phenylmethoxyethanone |
| SMILES | COc1ccc(C2CN(C(=O)COCc3ccccc3)CC2(C)[C@@H](C)O)cc1OC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C33H45NO5/c1-23(35)33(2)22-34(32(36)21-38-20-24-9-5-4-6-10-24)19-29(33)27-14-16-30(37-3)31(18-27)39-28-15-13-25-11-7-8-12-26(25)17-28/h4-6,9-10,14,16,18,23,25-26,28-29,35H,7-8,11-13,15,17,19-22H2,1-3H3/t23-,25?,26?,28?,29?,33?/m1/s1 |
| InChIKey | MPGRELMITQDFPX-JLEAHCMTSA-N |
| XLogP | 5.96 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |