About aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile
aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile (PubChem CID 69421706) has the molecular formula C6H13N6O2P
and a molecular weight of 232.18 g/mol. Its IUPAC name is aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile.
Molecular Properties
| Compound Name | aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile |
| PubChem CID | 69421706 |
| Molecular Formula | C6H13N6O2P |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile |
| SMILES | CCc1nnn(CCC#N)n1.NP(O)O |
| InChI | InChI=1S/C6H9N5.H4NO2P/c1-2-6-8-10-11(9-6)5-3-4-7;1-4(2)3/h2-3,5H2,1H3;2-3H,1H2 |
| InChIKey | VANGPPPQSLHODT-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile?
The IUPAC name of aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile (CID 69421706) is aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile.
What is the SMILES notation for aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile?
The canonical SMILES for aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile is CCc1nnn(CCC#N)n1.NP(O)O.
What is the InChIKey of aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile?
The InChIKey is VANGPPPQSLHODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5.H4NO2P/c1-2-6-8-10-11(9-6)5-3-4-7;1-4(2)3/h2-3,5H2,1H3;2-3H,1H2.
What are the key properties of aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile?
aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile has a molecular weight of 232.18 g/mol, XLogP of -0.69, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for aminophosphonous acid;3-(5-ethyltetrazol-2-yl)propanenitrile is sourced from PubChem (CID 69421706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).