C15H17N3O5S — CID 69421959
7-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylmethyl)-6-methoxycarbonyl-4,7-dihydro-1,4-thiazepine-3-carboxylic acid (PubChem CID 69421959) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 7-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylmethyl)-6-methoxycarbonyl-4,7-dihydro-1,4-thiazepine-3-carboxylic acid.
| Compound Name | 7-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylmethyl)-6-methoxycarbonyl-4,7-dihydro-1,4-thiazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 69421959 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 7-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylmethyl)-6-methoxycarbonyl-4,7-dihydro-1,4-thiazepine-3-carboxylic acid |
| SMILES | COC(=O)C1=CNC(C(=O)O)=CSC1Cc1cc2n(n1)CCOC2 |
| InChI | InChI=1S/C15H17N3O5S/c1-22-15(21)11-6-16-12(14(19)20)8-24-13(11)5-9-4-10-7-23-3-2-18(10)17-9/h4,6,8,13,16H,2-3,5,7H2,1H3,(H,19,20) |
| InChIKey | ZAOWPCRWUPLNPS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |