C10H14ClN3O3 — CID 89188097
methyl 2-chloro-4-morpholin-4-yl-1,2-dihydropyrimidine-6-carboxylate (PubChem CID 89188097) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is methyl 2-chloro-4-morpholin-4-yl-1,2-dihydropyrimidine-6-carboxylate.
| Compound Name | methyl 2-chloro-4-morpholin-4-yl-1,2-dihydropyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 89188097 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | methyl 2-chloro-4-morpholin-4-yl-1,2-dihydropyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=CC(N2CCOCC2)=NC(Cl)N1 |
| InChI | InChI=1S/C10H14ClN3O3/c1-16-9(15)7-6-8(13-10(11)12-7)14-2-4-17-5-3-14/h6,10,12H,2-5H2,1H3 |
| InChIKey | DZXYWRUJJIFYOH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|