C34H48NO3Si — CID 69422439
CID 69422439 (PubChem CID 69422439) has the molecular formula C34H48NO3Si and a molecular weight of 546.85 g/mol.
| Compound Name | CID 69422439 |
|---|---|
| PubChem CID | 69422439 |
| Molecular Formula | C34H48NO3Si |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(c1ccccc1[C@H](OC[C@H](O)CNC(C)(C)Cc1ccc2ccccc2c1)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C34H48NO3Si/c1-33(2,3)32(38-39(6)7)30-15-11-10-14-29(30)31(26-18-19-26)37-23-28(36)22-35-34(4,5)21-24-16-17-25-12-8-9-13-27(25)20-24/h8-17,20,26,28,31-32,35-36H,18-19,21-23H2,1-7H3/t28-,31-,32?/m1/s1 |
| InChIKey | BKINJRJJRFCIGR-ZQOCYEGCSA-N |
| XLogP | 7.63 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|