C27H38N4O4S — CID 69423831
4-[(4-butoxyphenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide (PubChem CID 69423831) has the molecular formula C27H38N4O4S and a molecular weight of 514.69 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide.
| Compound Name | 4-[(4-butoxyphenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 69423831 |
| Molecular Formula | C27H38N4O4S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 4-[(4-butoxyphenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)CNCCCC(=O)N(C)CCc2ccc(C3=NCCN3)cc2)cc1 |
| InChI | InChI=1S/C27H38N4O4S/c1-3-4-20-35-24-11-13-25(14-12-24)36(33,34)21-28-16-5-6-26(32)31(2)19-15-22-7-9-23(10-8-22)27-29-17-18-30-27/h7-14,28H,3-6,15-21H2,1-2H3,(H,29,30) |
| InChIKey | KQGMULVOLOWDMJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|