C25H26N2O7 — CID 69425998
2-[3-[[[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]pyridine-3-carbonyl]amino]methyl]cyclopent-3-en-1-yl]oxypropanoic acid (PubChem CID 69425998) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-[3-[[[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]pyridine-3-carbonyl]amino]methyl]cyclopent-3-en-1-yl]oxypropanoic acid.
| Compound Name | 2-[3-[[[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]pyridine-3-carbonyl]amino]methyl]cyclopent-3-en-1-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 69425998 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-[3-[[[2-[(2-benzyl-1,3-dioxol-4-yl)oxy]pyridine-3-carbonyl]amino]methyl]cyclopent-3-en-1-yl]oxypropanoic acid |
| SMILES | CC(OC1CC=C(CNC(=O)c2cccnc2OC2=COC(Cc3ccccc3)O2)C1)C(=O)O |
| InChI | InChI=1S/C25H26N2O7/c1-16(25(29)30)32-19-10-9-18(12-19)14-27-23(28)20-8-5-11-26-24(20)34-22-15-31-21(33-22)13-17-6-3-2-4-7-17/h2-9,11,15-16,19,21H,10,12-14H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | SKBYQFKRGPZAHL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|