C13H17NO3 — CID 69426851
4-hydroxy-3,5,5-trimethyl-3-phenylmorpholin-2-one (PubChem CID 69426851) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 4-hydroxy-3,5,5-trimethyl-3-phenylmorpholin-2-one.
| Compound Name | 4-hydroxy-3,5,5-trimethyl-3-phenylmorpholin-2-one |
|---|---|
| PubChem CID | 69426851 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-hydroxy-3,5,5-trimethyl-3-phenylmorpholin-2-one |
| SMILES | CC1(C)COC(=O)C(C)(c2ccccc2)N1O |
| InChI | InChI=1S/C13H17NO3/c1-12(2)9-17-11(15)13(3,14(12)16)10-7-5-4-6-8-10/h4-8,16H,9H2,1-3H3 |
| InChIKey | NBCPPLPEULFZIV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |