C20H23NO3 — CID 22340196
1-hydroxy-2,6-dimethyl-2,6-diphenylpiperidine-4-carboxylic acid (PubChem CID 22340196) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-hydroxy-2,6-dimethyl-2,6-diphenylpiperidine-4-carboxylic acid.
| Compound Name | 1-hydroxy-2,6-dimethyl-2,6-diphenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22340196 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-hydroxy-2,6-dimethyl-2,6-diphenylpiperidine-4-carboxylic acid |
| SMILES | CC1(c2ccccc2)CC(C(=O)O)CC(C)(c2ccccc2)N1O |
| InChI | InChI=1S/C20H23NO3/c1-19(16-9-5-3-6-10-16)13-15(18(22)23)14-20(2,21(19)24)17-11-7-4-8-12-17/h3-12,15,24H,13-14H2,1-2H3,(H,22,23) |
| InChIKey | LXRIXWRPAUYJEU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |