C26H35N3O5S — CID 69427530
9-[[2-(2-methylpropoxy)phenyl]methyl]-3-(3-nitrophenyl)sulfonyl-3,9-diazaspiro[5.5]undecane (PubChem CID 69427530) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is 9-[[2-(2-methylpropoxy)phenyl]methyl]-3-(3-nitrophenyl)sulfonyl-3,9-diazaspiro[5.5]undecane.
| Compound Name | 9-[[2-(2-methylpropoxy)phenyl]methyl]-3-(3-nitrophenyl)sulfonyl-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 69427530 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 9-[[2-(2-methylpropoxy)phenyl]methyl]-3-(3-nitrophenyl)sulfonyl-3,9-diazaspiro[5.5]undecane |
| SMILES | CC(C)COc1ccccc1CN1CCC2(CC1)CCN(S(=O)(=O)c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C26H35N3O5S/c1-21(2)20-34-25-9-4-3-6-22(25)19-27-14-10-26(11-15-27)12-16-28(17-13-26)35(32,33)24-8-5-7-23(18-24)29(30)31/h3-9,18,21H,10-17,19-20H2,1-2H3 |
| InChIKey | SXCXBHLEHGWMJO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|