C20H22N2O3S — CID 69427955
[4-(2,3-dihydro-1H-indol-3-ylsulfonyl)phenyl]-piperidin-1-ylmethanone (PubChem CID 69427955) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is [4-(2,3-dihydro-1H-indol-3-ylsulfonyl)phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-(2,3-dihydro-1H-indol-3-ylsulfonyl)phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 69427955 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [4-(2,3-dihydro-1H-indol-3-ylsulfonyl)phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(S(=O)(=O)C2CNc3ccccc32)cc1)N1CCCCC1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20(22-12-4-1-5-13-22)15-8-10-16(11-9-15)26(24,25)19-14-21-18-7-3-2-6-17(18)19/h2-3,6-11,19,21H,1,4-5,12-14H2 |
| InChIKey | BOHXNJQSGFSOLG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |