About 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole
4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole (PubChem CID 69430739) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole.
Molecular Properties
| Compound Name | 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole |
| PubChem CID | 69430739 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole |
| SMILES | Cc1c(O[C@H]2CCC[C@H](C(C)(C)[N+](=O)[O-])C2)ccc2[nH]ncc12 |
| InChI | InChI=1S/C17H23N3O3/c1-11-14-10-18-19-15(14)7-8-16(11)23-13-6-4-5-12(9-13)17(2,3)20(21)22/h7-8,10,12-13H,4-6,9H2,1-3H3,(H,18,19)/t12-,13-/m0/s1 |
| InChIKey | WYWIUUGDKOWTOW-STQMWFEESA-N |
| XLogP | 3.86 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole?
The IUPAC name of 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole (CID 69430739) is 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole.
What is the SMILES notation for 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole?
The canonical SMILES for 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole is Cc1c(O[C@H]2CCC[C@H](C(C)(C)[N+](=O)[O-])C2)ccc2[nH]ncc12.
What is the InChIKey of 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole?
The InChIKey is WYWIUUGDKOWTOW-STQMWFEESA-N. The full InChI is InChI=1S/C17H23N3O3/c1-11-14-10-18-19-15(14)7-8-16(11)23-13-6-4-5-12(9-13)17(2,3)20(21)22/h7-8,10,12-13H,4-6,9H2,1-3H3,(H,18,19)/t12-,13-/m0/s1.
What are the key properties of 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole?
4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole has a molecular weight of 317.39 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-[(1S,3S)-3-(2-nitropropan-2-yl)cyclohexyl]oxy-1H-indazole is sourced from PubChem (CID 69430739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).