About N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline
N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline (PubChem CID 69432381) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline.
Molecular Properties
| Compound Name | N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline |
| PubChem CID | 69432381 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline |
| SMILES | Cc1c(O[C@H]2CCC[C@@H](N(C)c3ccccc3)C2)ccc2[nH]ncc12 |
| InChI | InChI=1S/C21H25N3O/c1-15-19-14-22-23-20(19)11-12-21(15)25-18-10-6-9-17(13-18)24(2)16-7-4-3-5-8-16/h3-5,7-8,11-12,14,17-18H,6,9-10,13H2,1-2H3,(H,22,23)/t17-,18+/m1/s1 |
| InChIKey | FPUMTUKKGUOLRC-MSOLQXFVSA-N |
| XLogP | 4.70 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline?
The IUPAC name of N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline (CID 69432381) is N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline.
What is the SMILES notation for N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline?
The canonical SMILES for N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline is Cc1c(O[C@H]2CCC[C@@H](N(C)c3ccccc3)C2)ccc2[nH]ncc12.
What is the InChIKey of N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline?
The InChIKey is FPUMTUKKGUOLRC-MSOLQXFVSA-N. The full InChI is InChI=1S/C21H25N3O/c1-15-19-14-22-23-20(19)11-12-21(15)25-18-10-6-9-17(13-18)24(2)16-7-4-3-5-8-16/h3-5,7-8,11-12,14,17-18H,6,9-10,13H2,1-2H3,(H,22,23)/t17-,18+/m1/s1.
What are the key properties of N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline?
N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline has a molecular weight of 335.45 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(1R,3S)-3-[(4-methyl-1H-indazol-5-yl)oxy]cyclohexyl]aniline is sourced from PubChem (CID 69432381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).