About ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole
ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole (PubChem CID 69434908) has the molecular formula C32H27N3O4
and a molecular weight of 517.59 g/mol. Its IUPAC name is ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole.
Molecular Properties
| Compound Name | ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole |
| PubChem CID | 69434908 |
| Molecular Formula | C32H27N3O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole |
| SMILES | CCOC(=O)c1cc2ccccc2[nH]1.O=[N+]([O-])c1ccc(Cn2cc(-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H16N2O2.C11H11NO2/c24-23(25)18-12-10-16(11-13-18)14-22-15-20(17-6-2-1-3-7-17)19-8-4-5-9-21(19)22;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h1-13,15H,14H2;3-7,12H,2H2,1H3 |
| InChIKey | NNPAFGCYSQCQHD-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole?
The IUPAC name of ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole (CID 69434908) is ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole.
What is the SMILES notation for ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole?
The canonical SMILES for ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole is CCOC(=O)c1cc2ccccc2[nH]1.O=[N+]([O-])c1ccc(Cn2cc(-c3ccccc3)c3ccccc32)cc1.
What is the InChIKey of ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole?
The InChIKey is NNPAFGCYSQCQHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2.C11H11NO2/c24-23(25)18-12-10-16(11-13-18)14-22-15-20(17-6-2-1-3-7-17)19-8-4-5-9-21(19)22;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h1-13,15H,14H2;3-7,12H,2H2,1H3.
What are the key properties of ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole?
ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole has a molecular weight of 517.59 g/mol, XLogP of 7.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1H-indole-2-carboxylate;1-[(4-nitrophenyl)methyl]-3-phenylindole is sourced from PubChem (CID 69434908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).