C7H14N4 — CID 69434990
(1,4-diethylpyrazol-5-yl)hydrazine (PubChem CID 69434990) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is (1,4-diethylpyrazol-5-yl)hydrazine.
| Compound Name | (1,4-diethylpyrazol-5-yl)hydrazine |
|---|---|
| PubChem CID | 69434990 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (1,4-diethylpyrazol-5-yl)hydrazine |
| SMILES | CCc1cnn(CC)c1NN |
| InChI | InChI=1S/C7H14N4/c1-3-6-5-9-11(4-2)7(6)10-8/h5,10H,3-4,8H2,1-2H3 |
| InChIKey | FNQOPRZRXXDRGT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|