C18H15N5S — CID 69436200
N-phenyl-3-(quinolin-8-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 69436200) has the molecular formula C18H15N5S and a molecular weight of 333.42 g/mol. Its IUPAC name is N-phenyl-3-(quinolin-8-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N-phenyl-3-(quinolin-8-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 69436200 |
| Molecular Formula | C18H15N5S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-phenyl-3-(quinolin-8-ylmethylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | c1ccc(Nc2nc(SCc3cccc4cccnc34)n[nH]2)cc1 |
| InChI | InChI=1S/C18H15N5S/c1-2-9-15(10-3-1)20-17-21-18(23-22-17)24-12-14-7-4-6-13-8-5-11-19-16(13)14/h1-11H,12H2,(H2,20,21,22,23) |
| InChIKey | IPLOAZLPBYLTDR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |