C28H30N2O4S — CID 69438102
9-benzylsulfonyl-2-[(4-phenoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 69438102) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 9-benzylsulfonyl-2-[(4-phenoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 9-benzylsulfonyl-2-[(4-phenoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 69438102 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 9-benzylsulfonyl-2-[(4-phenoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(Cc2ccc(Oc3ccccc3)cc2)CCC12CCCN(S(=O)(=O)Cc1ccccc1)C2 |
| InChI | InChI=1S/C28H30N2O4S/c31-27-28(16-7-18-30(22-28)35(32,33)21-24-8-3-1-4-9-24)17-19-29(27)20-23-12-14-26(15-13-23)34-25-10-5-2-6-11-25/h1-6,8-15H,7,16-22H2 |
| InChIKey | SGCKZBBGXNEDGJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |