C27H28N2O4S — CID 69435907
9-(4-methylphenyl)sulfonyl-2-(4-phenoxyphenyl)-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 69435907) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 9-(4-methylphenyl)sulfonyl-2-(4-phenoxyphenyl)-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 9-(4-methylphenyl)sulfonyl-2-(4-phenoxyphenyl)-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 69435907 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 9-(4-methylphenyl)sulfonyl-2-(4-phenoxyphenyl)-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC3(CCN(c4ccc(Oc5ccccc5)cc4)C3=O)C2)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c1-21-8-14-25(15-9-21)34(31,32)28-18-5-16-27(20-28)17-19-29(26(27)30)22-10-12-24(13-11-22)33-23-6-3-2-4-7-23/h2-4,6-15H,5,16-20H2,1H3 |
| InChIKey | DGWBOXFCYGDERJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |