C28H35ClN4O5 — CID 69440917
N-[4-(4-chloroanilino)-1-(2-morpholin-4-ylethoxy)-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide (PubChem CID 69440917) has the molecular formula C28H35ClN4O5 and a molecular weight of 543.06 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-1-(2-morpholin-4-ylethoxy)-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide.
| Compound Name | N-[4-(4-chloroanilino)-1-(2-morpholin-4-ylethoxy)-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 69440917 |
| Molecular Formula | C28H35ClN4O5 |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | N-[4-(4-chloroanilino)-1-(2-morpholin-4-ylethoxy)-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide |
| SMILES | O=C(CC(COCCN1CCOCC1)NC(=O)c1ccc(N2CCCCC2=O)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H35ClN4O5/c29-22-6-8-23(9-7-22)30-26(34)19-24(20-38-18-15-32-13-16-37-17-14-32)31-28(36)21-4-10-25(11-5-21)33-12-2-1-3-27(33)35/h4-11,24H,1-3,12-20H2,(H,30,34)(H,31,36) |
| InChIKey | MIZYRCBDDJHZLB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|