C28H35ClN4O6S — CID 69441450
N-[4-(4-chloroanilino)-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide (PubChem CID 69441450) has the molecular formula C28H35ClN4O6S and a molecular weight of 591.13 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide.
| Compound Name | N-[4-(4-chloroanilino)-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 69441450 |
| Molecular Formula | C28H35ClN4O6S |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | N-[4-(4-chloroanilino)-1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-4-oxobutan-2-yl]-4-(2-oxopiperidin-1-yl)benzamide |
| SMILES | O=C(CC(COCCN1CCS(=O)(=O)CC1)NC(=O)c1ccc(N2CCCCC2=O)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H35ClN4O6S/c29-22-6-8-23(9-7-22)30-26(34)19-24(20-39-16-13-32-14-17-40(37,38)18-15-32)31-28(36)21-4-10-25(11-5-21)33-12-2-1-3-27(33)35/h4-11,24H,1-3,12-20H2,(H,30,34)(H,31,36) |
| InChIKey | PKQCAJALDMEBCU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|