C32H34N6O2 — CID 69441789
7-[[2-[5-[(2-aminoethylamino)methyl]-1H-imidazol-2-yl]-4-pyridinyl]oxy]-N-(3-tert-butylphenyl)naphthalene-2-carboxamide (PubChem CID 69441789) has the molecular formula C32H34N6O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 7-[[2-[5-[(2-aminoethylamino)methyl]-1H-imidazol-2-yl]-4-pyridinyl]oxy]-N-(3-tert-butylphenyl)naphthalene-2-carboxamide.
| Compound Name | 7-[[2-[5-[(2-aminoethylamino)methyl]-1H-imidazol-2-yl]-4-pyridinyl]oxy]-N-(3-tert-butylphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 69441789 |
| Molecular Formula | C32H34N6O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 7-[[2-[5-[(2-aminoethylamino)methyl]-1H-imidazol-2-yl]-4-pyridinyl]oxy]-N-(3-tert-butylphenyl)naphthalene-2-carboxamide |
| SMILES | CC(C)(C)c1cccc(NC(=O)c2ccc3ccc(Oc4ccnc(-c5ncc(CNCCN)[nH]5)c4)cc3c2)c1 |
| InChI | InChI=1S/C32H34N6O2/c1-32(2,3)24-5-4-6-25(17-24)38-31(39)22-8-7-21-9-10-27(16-23(21)15-22)40-28-11-13-35-29(18-28)30-36-20-26(37-30)19-34-14-12-33/h4-11,13,15-18,20,34H,12,14,19,33H2,1-3H3,(H,36,37)(H,38,39) |
| InChIKey | RSJOHLZWFUNHNU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|