C32H42O — CID 69442758
2-[2,6-bis(3-methylbut-3-enyl)phenoxy]-1,3-bis(3-methylbut-3-enyl)benzene (PubChem CID 69442758) has the molecular formula C32H42O and a molecular weight of 442.69 g/mol. Its IUPAC name is 2-[2,6-bis(3-methylbut-3-enyl)phenoxy]-1,3-bis(3-methylbut-3-enyl)benzene.
| Compound Name | 2-[2,6-bis(3-methylbut-3-enyl)phenoxy]-1,3-bis(3-methylbut-3-enyl)benzene |
|---|---|
| PubChem CID | 69442758 |
| Molecular Formula | C32H42O |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | 2-[2,6-bis(3-methylbut-3-enyl)phenoxy]-1,3-bis(3-methylbut-3-enyl)benzene |
| SMILES | C=C(C)CCc1cccc(CCC(=C)C)c1Oc1c(CCC(=C)C)cccc1CCC(=C)C |
| InChI | InChI=1S/C32H42O/c1-23(2)15-19-27-11-9-12-28(20-16-24(3)4)31(27)33-32-29(21-17-25(5)6)13-10-14-30(32)22-18-26(7)8/h9-14H,1,3,5,7,15-22H2,2,4,6,8H3 |
| InChIKey | CEZYDJDANGCLSQ-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|