C39H45N3O3 — CID 139779860
2,4,6-tris[2-ethyl-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine (PubChem CID 139779860) has the molecular formula C39H45N3O3 and a molecular weight of 603.81 g/mol. Its IUPAC name is 2,4,6-tris[2-ethyl-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[2-ethyl-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 139779860 |
| Molecular Formula | C39H45N3O3 |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.35 |
| IUPAC Name | 2,4,6-tris[2-ethyl-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine |
| SMILES | C=C(C)Cc1cccc(CC)c1Oc1nc(Oc2c(CC)cccc2CC(=C)C)nc(Oc2c(CC)cccc2CC(=C)C)n1 |
| InChI | InChI=1S/C39H45N3O3/c1-10-28-16-13-19-31(22-25(4)5)34(28)43-37-40-38(44-35-29(11-2)17-14-20-32(35)23-26(6)7)42-39(41-37)45-36-30(12-3)18-15-21-33(36)24-27(8)9/h13-21H,4,6,8,10-12,22-24H2,1-3,5,7,9H3 |
| InChIKey | VHWUYHWQZLVKNP-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|