C36H39N3O3 — CID 139779893
2-[4-methyl-2-(2-methylprop-1-enyl)phenoxy]-4,6-bis[4-methyl-2-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine (PubChem CID 139779893) has the molecular formula C36H39N3O3 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2-[4-methyl-2-(2-methylprop-1-enyl)phenoxy]-4,6-bis[4-methyl-2-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine.
| Compound Name | 2-[4-methyl-2-(2-methylprop-1-enyl)phenoxy]-4,6-bis[4-methyl-2-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 139779893 |
| Molecular Formula | C36H39N3O3 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | 2-[4-methyl-2-(2-methylprop-1-enyl)phenoxy]-4,6-bis[4-methyl-2-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine |
| SMILES | C=C(C)Cc1cc(C)ccc1Oc1nc(Oc2ccc(C)cc2C=C(C)C)nc(Oc2ccc(C)cc2CC(=C)C)n1 |
| InChI | InChI=1S/C36H39N3O3/c1-22(2)16-28-19-25(7)10-13-31(28)40-34-37-35(41-32-14-11-26(8)20-29(32)17-23(3)4)39-36(38-34)42-33-15-12-27(9)21-30(33)18-24(5)6/h10-15,18-21H,1,3,16-17H2,2,4-9H3 |
| InChIKey | KELDVCBUTLBJDF-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|