About acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene
acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene (PubChem CID 142986074) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene.
Molecular Properties
| Compound Name | acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene |
| PubChem CID | 142986074 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene |
| SMILES | C#C.CC(C)=Cc1ccc(C)cc1C |
| InChI | InChI=1S/C12H16.C2H2/c1-9(2)7-12-6-5-10(3)8-11(12)4;1-2/h5-8H,1-4H3;1-2H |
| InChIKey | KOXZXPQNVKGIHE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene?
The IUPAC name of acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene (CID 142986074) is acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene.
What is the SMILES notation for acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene?
The canonical SMILES for acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene is C#C.CC(C)=Cc1ccc(C)cc1C.
What is the InChIKey of acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene?
The InChIKey is KOXZXPQNVKGIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C2H2/c1-9(2)7-12-6-5-10(3)8-11(12)4;1-2/h5-8H,1-4H3;1-2H.
What are the key properties of acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene?
acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene has a molecular weight of 186.30 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2,4-dimethyl-1-(2-methylprop-1-enyl)benzene is sourced from PubChem (CID 142986074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).