C21H28N2O2 — CID 69442860
5-(aminomethyl)-4-(4-methylphenyl)-6-(2-methylpropyl)-2-propylpyridine-3-carboxylic acid (PubChem CID 69442860) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 5-(aminomethyl)-4-(4-methylphenyl)-6-(2-methylpropyl)-2-propylpyridine-3-carboxylic acid.
| Compound Name | 5-(aminomethyl)-4-(4-methylphenyl)-6-(2-methylpropyl)-2-propylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 69442860 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 5-(aminomethyl)-4-(4-methylphenyl)-6-(2-methylpropyl)-2-propylpyridine-3-carboxylic acid |
| SMILES | CCCc1nc(CC(C)C)c(CN)c(-c2ccc(C)cc2)c1C(=O)O |
| InChI | InChI=1S/C21H28N2O2/c1-5-6-17-20(21(24)25)19(15-9-7-14(4)8-10-15)16(12-22)18(23-17)11-13(2)3/h7-10,13H,5-6,11-12,22H2,1-4H3,(H,24,25) |
| InChIKey | OQWADZKFOFUDGM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |