C24H34N2O — CID 141114937
5-hexyl-2-methyl-4-(4-methylphenyl)-6-(2-methylpropyl)pyridine-3-carboxamide (PubChem CID 141114937) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is 5-hexyl-2-methyl-4-(4-methylphenyl)-6-(2-methylpropyl)pyridine-3-carboxamide.
| Compound Name | 5-hexyl-2-methyl-4-(4-methylphenyl)-6-(2-methylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141114937 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 5-hexyl-2-methyl-4-(4-methylphenyl)-6-(2-methylpropyl)pyridine-3-carboxamide |
| SMILES | CCCCCCc1c(CC(C)C)nc(C)c(C(N)=O)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34N2O/c1-6-7-8-9-10-20-21(15-16(2)3)26-18(5)22(24(25)27)23(20)19-13-11-17(4)12-14-19/h11-14,16H,6-10,15H2,1-5H3,(H2,25,27) |
| InChIKey | UMIVDOUDDGFASM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|