C38H32F3NO7 — CID 69444556
ethyl 3-[4-(2-hydroxy-2,2-diphenylacetyl)oxy-3-methylphenyl]-2-[[4-methyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]methyl]-3-oxopropanoate (PubChem CID 69444556) has the molecular formula C38H32F3NO7 and a molecular weight of 671.67 g/mol. Its IUPAC name is ethyl 3-[4-(2-hydroxy-2,2-diphenylacetyl)oxy-3-methylphenyl]-2-[[4-methyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]methyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-(2-hydroxy-2,2-diphenylacetyl)oxy-3-methylphenyl]-2-[[4-methyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 69444556 |
| Molecular Formula | C38H32F3NO7 |
| Molecular Weight | 671.67 g/mol |
| Exact Mass | 671.21 |
| IUPAC Name | ethyl 3-[4-(2-hydroxy-2,2-diphenylacetyl)oxy-3-methylphenyl]-2-[[4-methyl-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]methyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1noc(-c2ccc(C(F)(F)F)cc2)c1C)C(=O)c1ccc(OC(=O)C(O)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C38H32F3NO7/c1-4-47-35(44)30(22-31-24(3)34(49-42-31)25-15-18-29(19-16-25)38(39,40)41)33(43)26-17-20-32(23(2)21-26)48-36(45)37(46,27-11-7-5-8-12-27)28-13-9-6-10-14-28/h5-21,30,46H,4,22H2,1-3H3 |
| InChIKey | DSVRUBARGDVQGM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|