C13H13N2O3- — CID 6944485
(2S)-2-(3-ethyl-4-oxophthalazin-1-yl)propanoate (PubChem CID 6944485) has the molecular formula C13H13N2O3- and a molecular weight of 245.26 g/mol. Its IUPAC name is (2S)-2-(3-ethyl-4-oxophthalazin-1-yl)propanoate.
| Compound Name | (2S)-2-(3-ethyl-4-oxophthalazin-1-yl)propanoate |
|---|---|
| PubChem CID | 6944485 |
| Molecular Formula | C13H13N2O3- |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (2S)-2-(3-ethyl-4-oxophthalazin-1-yl)propanoate |
| SMILES | CCn1nc([C@H](C)C(=O)[O-])c2ccccc2c1=O |
| InChI | InChI=1S/C13H14N2O3/c1-3-15-12(16)10-7-5-4-6-9(10)11(14-15)8(2)13(17)18/h4-8H,3H2,1-2H3,(H,17,18)/p-1/t8-/m0/s1 |
| InChIKey | XAXREQRLDORKRY-QMMMGPOBSA-M |
| XLogP | 0.27 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |