C21H25ClN2O4 — CID 69448117
5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1-oxidoquinolin-1-ium-8-ol;hydrochloride (PubChem CID 69448117) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1-oxidoquinolin-1-ium-8-ol;hydrochloride.
| Compound Name | 5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1-oxidoquinolin-1-ium-8-ol;hydrochloride |
|---|---|
| PubChem CID | 69448117 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1-oxidoquinolin-1-ium-8-ol;hydrochloride |
| SMILES | COc1ccc(C[C@@H](C)NC[C@H](O)c2ccc(O)c3c2ccc[n+]3[O-])cc1.Cl |
| InChI | InChI=1S/C21H24N2O4.ClH/c1-14(12-15-5-7-16(27-2)8-6-15)22-13-20(25)17-9-10-19(24)21-18(17)4-3-11-23(21)26;/h3-11,14,20,22,24-25H,12-13H2,1-2H3;1H/t14-,20+;/m1./s1 |
| InChIKey | RYMLBRLYYSQVSI-MRVNXENUSA-N |
| XLogP | 2.86 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|