C23H26N2O8 — CID 57009372
2-[2-formamido-3-hydroxy-6-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]but-2-enedioic acid (PubChem CID 57009372) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is 2-[2-formamido-3-hydroxy-6-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]but-2-enedioic acid.
| Compound Name | 2-[2-formamido-3-hydroxy-6-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 57009372 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[2-formamido-3-hydroxy-6-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]but-2-enedioic acid |
| SMILES | COc1ccc(CC(C)NCC(O)c2ccc(O)c(NC=O)c2C(=CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H26N2O8/c1-13(9-14-3-5-15(33-2)6-4-14)24-11-19(28)16-7-8-18(27)22(25-12-26)21(16)17(23(31)32)10-20(29)30/h3-8,10,12-13,19,24,27-28H,9,11H2,1-2H3,(H,25,26)(H,29,30)(H,31,32) |
| InChIKey | IYHMHEQTPSHBNC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|