C44H56N4O12 — CID 169443535
(E)-but-2-enedioic acid;bis(N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-yl-methylamino]ethyl]phenyl]formamide) (PubChem CID 169443535) has the molecular formula C44H56N4O12 and a molecular weight of 832.95 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-yl-methylamino]ethyl]phenyl]formamide).
| Compound Name | (E)-but-2-enedioic acid;bis(N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-yl-methylamino]ethyl]phenyl]formamide) |
|---|---|
| PubChem CID | 169443535 |
| Molecular Formula | C44H56N4O12 |
| Molecular Weight | 832.95 g/mol |
| Exact Mass | 832.39 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-yl-methylamino]ethyl]phenyl]formamide) |
| SMILES | COc1ccc(CC(C)N(C)CC(O)c2ccc(O)c(NC=O)c2)cc1.COc1ccc(CC(C)N(C)CC(O)c2ccc(O)c(NC=O)c2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C20H26N2O4.C4H4O4/c2*1-14(10-15-4-7-17(26-3)8-5-15)22(2)12-20(25)16-6-9-19(24)18(11-16)21-13-23;5-3(6)1-2-4(7)8/h2*4-9,11,13-14,20,24-25H,10,12H2,1-3H3,(H,21,23);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | ZIPAOPKQBZYCCG-WXXKFALUSA-N |
| XLogP | 4.84 |
| TPSA | 238.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.95 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|