C19H24N2O4 — CID 89251105
N-[2-hydroxy-5-[(1R)-1-hydroxy-1-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide (PubChem CID 89251105) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(1R)-1-hydroxy-1-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide.
| Compound Name | N-[2-hydroxy-5-[(1R)-1-hydroxy-1-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide |
|---|---|
| PubChem CID | 89251105 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[2-hydroxy-5-[(1R)-1-hydroxy-1-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenyl]formamide |
| SMILES | COc1ccc(C[C@@H](C)N[C@](C)(O)c2ccc(O)c(NC=O)c2)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-13(10-14-4-7-16(25-3)8-5-14)21-19(2,24)15-6-9-18(23)17(11-15)20-12-22/h4-9,11-13,21,23-24H,10H2,1-3H3,(H,20,22)/t13-,19-/m1/s1 |
| InChIKey | WWYVZNVWWUOPKZ-BFUOFWGJSA-N |
| XLogP | 2.35 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|