C21H26N2O4 — CID 57118675
N-[2-hydroxy-5-[hydroxy-[5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-yl]methyl]phenyl]formamide (PubChem CID 57118675) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[2-hydroxy-5-[hydroxy-[5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-yl]methyl]phenyl]formamide.
| Compound Name | N-[2-hydroxy-5-[hydroxy-[5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-yl]methyl]phenyl]formamide |
|---|---|
| PubChem CID | 57118675 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[2-hydroxy-5-[hydroxy-[5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-yl]methyl]phenyl]formamide |
| SMILES | COc1ccc(CCC2CCC(C(O)c3ccc(O)c(NC=O)c3)N2)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-27-17-8-3-14(4-9-17)2-6-16-7-10-18(23-16)21(26)15-5-11-20(25)19(12-15)22-13-24/h3-5,8-9,11-13,16,18,21,23,25-26H,2,6-7,10H2,1H3,(H,22,24) |
| InChIKey | WZXVNJMZDNDPOW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|