C35H56O4 — CID 69448479
10-(diethoxymethyl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysen-9-one (PubChem CID 69448479) has the molecular formula C35H56O4 and a molecular weight of 540.83 g/mol. Its IUPAC name is 10-(diethoxymethyl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysen-9-one.
| Compound Name | 10-(diethoxymethyl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysen-9-one |
|---|---|
| PubChem CID | 69448479 |
| Molecular Formula | C35H56O4 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | 10-(diethoxymethyl)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,11b,12,13,13a,13b-dodecahydro-1H-cyclopenta[a]chrysen-9-one |
| SMILES | C=C(C)C1CCC2(CO)CCC3(C)C(CCC4C5(C)C=C(C(OCC)OCC)C(=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C35H56O4/c1-10-38-30(39-11-2)24-20-32(7)26(31(5,6)29(24)37)15-16-34(9)27(32)13-12-25-28-23(22(3)4)14-17-35(28,21-36)19-18-33(25,34)8/h20,23,25-28,30,36H,3,10-19,21H2,1-2,4-9H3 |
| InChIKey | JAOQALKBWOZAAS-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|